C23H28FNO4S — CID 2522750
(4-tert-butyl-2-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 2522750) has the molecular formula C23H28FNO4S and a molecular weight of 433.55 g/mol. Its IUPAC name is (4-tert-butyl-2-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-tert-butyl-2-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 2522750 |
| Molecular Formula | C23H28FNO4S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (4-tert-butyl-2-methylphenyl) 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H28FNO4S/c1-16-15-18(23(2,3)4)9-10-20(16)29-22(26)17-11-13-25(14-12-17)30(27,28)21-8-6-5-7-19(21)24/h5-10,15,17H,11-14H2,1-4H3 |
| InChIKey | GASSWTGQEJZMRV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|