C19H16BrFN2O4S — CID 55413069
(4-bromo-2-fluorophenyl) 1-(2-cyanophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55413069) has the molecular formula C19H16BrFN2O4S and a molecular weight of 467.32 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl) 1-(2-cyanophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (4-bromo-2-fluorophenyl) 1-(2-cyanophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55413069 |
| Molecular Formula | C19H16BrFN2O4S |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | (4-bromo-2-fluorophenyl) 1-(2-cyanophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCC(C(=O)Oc2ccc(Br)cc2F)CC1 |
| InChI | InChI=1S/C19H16BrFN2O4S/c20-15-5-6-17(16(21)11-15)27-19(24)13-7-9-23(10-8-13)28(25,26)18-4-2-1-3-14(18)12-22/h1-6,11,13H,7-10H2 |
| InChIKey | XXOHMHWGNWXQAO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|