C19H17F2N3O3S — CID 55414122
1-(2-cyanophenyl)sulfonyl-N-(2,6-difluorophenyl)piperidine-4-carboxamide (PubChem CID 55414122) has the molecular formula C19H17F2N3O3S and a molecular weight of 405.43 g/mol. Its IUPAC name is 1-(2-cyanophenyl)sulfonyl-N-(2,6-difluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-cyanophenyl)sulfonyl-N-(2,6-difluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55414122 |
| Molecular Formula | C19H17F2N3O3S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 1-(2-cyanophenyl)sulfonyl-N-(2,6-difluorophenyl)piperidine-4-carboxamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCC(C(=O)Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H17F2N3O3S/c20-15-5-3-6-16(21)18(15)23-19(25)13-8-10-24(11-9-13)28(26,27)17-7-2-1-4-14(17)12-22/h1-7,13H,8-11H2,(H,23,25) |
| InChIKey | OWFUWOHFQOFHTR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |