C20H21N3O3S2 — CID 9180398
1-(2-cyanophenyl)sulfonyl-N-(4-methylsulfanylphenyl)piperidine-4-carboxamide (PubChem CID 9180398) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(2-cyanophenyl)sulfonyl-N-(4-methylsulfanylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-cyanophenyl)sulfonyl-N-(4-methylsulfanylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9180398 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(2-cyanophenyl)sulfonyl-N-(4-methylsulfanylphenyl)piperidine-4-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccccc3C#N)CC2)cc1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-27-18-8-6-17(7-9-18)22-20(24)15-10-12-23(13-11-15)28(25,26)19-5-3-2-4-16(19)14-21/h2-9,15H,10-13H2,1H3,(H,22,24) |
| InChIKey | MVYQUEVUHXLWME-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |