C20H24N2O5S3 — CID 16935217
N-(4-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16935217) has the molecular formula C20H24N2O5S3 and a molecular weight of 468.62 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16935217 |
| Molecular Formula | C20H24N2O5S3 |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-1-(4-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CCN(S(=O)(=O)c3ccc(S(C)(=O)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O5S3/c1-28-17-5-3-16(4-6-17)21-20(23)15-11-13-22(14-12-15)30(26,27)19-9-7-18(8-10-19)29(2,24)25/h3-10,15H,11-14H2,1-2H3,(H,21,23) |
| InChIKey | HCZPJPUHTAHJAX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |