C18H21N3O3S2 — CID 46602451
N-(4-methylsulfanylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 46602451) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-methylsulfanylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46602451 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-25-16-6-4-15(5-7-16)20-18(22)14-8-11-21(12-9-14)26(23,24)17-3-2-10-19-13-17/h2-7,10,13-14H,8-9,11-12H2,1H3,(H,20,22) |
| InChIKey | BTESBNCZQDSOQW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |