C17H17F2N3O3S — CID 40637703
N-(3,4-difluorophenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 40637703) has the molecular formula C17H17F2N3O3S and a molecular weight of 381.40 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 40637703 |
| Molecular Formula | C17H17F2N3O3S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C17H17F2N3O3S/c18-15-4-3-13(10-16(15)19)21-17(23)12-5-8-22(9-6-12)26(24,25)14-2-1-7-20-11-14/h1-4,7,10-12H,5-6,8-9H2,(H,21,23) |
| InChIKey | TZEOMDDYXBNFIA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |