C18H16ClF2NO4S — CID 26096661
(2-chlorophenyl) 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 26096661) has the molecular formula C18H16ClF2NO4S and a molecular weight of 415.85 g/mol. Its IUPAC name is (2-chlorophenyl) 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-chlorophenyl) 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 26096661 |
| Molecular Formula | C18H16ClF2NO4S |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (2-chlorophenyl) 1-(3,4-difluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | O=C(Oc1ccccc1Cl)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H16ClF2NO4S/c19-14-3-1-2-4-17(14)26-18(23)12-7-9-22(10-8-12)27(24,25)13-5-6-15(20)16(21)11-13/h1-6,11-12H,7-10H2 |
| InChIKey | XBMRJBUQCOSEIZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|