C21H19ClFNO5S — CID 34155150
1-benzofuran-2-ylmethyl 1-(3-chloro-4-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 34155150) has the molecular formula C21H19ClFNO5S and a molecular weight of 451.90 g/mol. Its IUPAC name is 1-benzofuran-2-ylmethyl 1-(3-chloro-4-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 1-benzofuran-2-ylmethyl 1-(3-chloro-4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 34155150 |
| Molecular Formula | C21H19ClFNO5S |
| Molecular Weight | 451.90 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 1-benzofuran-2-ylmethyl 1-(3-chloro-4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | O=C(OCc1cc2ccccc2o1)C1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C21H19ClFNO5S/c22-18-12-17(5-6-19(18)23)30(26,27)24-9-7-14(8-10-24)21(25)28-13-16-11-15-3-1-2-4-20(15)29-16/h1-6,11-12,14H,7-10,13H2 |
| InChIKey | HIEDNULEBRQQIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |