C20H19ClN2O5S — CID 31144574
1-benzofuran-2-ylmethyl 1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate (PubChem CID 31144574) has the molecular formula C20H19ClN2O5S and a molecular weight of 434.90 g/mol. Its IUPAC name is 1-benzofuran-2-ylmethyl 1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate.
| Compound Name | 1-benzofuran-2-ylmethyl 1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31144574 |
| Molecular Formula | C20H19ClN2O5S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 1-benzofuran-2-ylmethyl 1-[(2-chloro-3-pyridinyl)sulfonyl]piperidine-4-carboxylate |
| SMILES | O=C(OCc1cc2ccccc2o1)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C20H19ClN2O5S/c21-19-18(6-3-9-22-19)29(25,26)23-10-7-14(8-11-23)20(24)27-13-16-12-15-4-1-2-5-17(15)28-16/h1-6,9,12,14H,7-8,10-11,13H2 |
| InChIKey | REFCCDGUWLDNHE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|