C17H24ClN3O3S — CID 51331040
[1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-(2-methylpiperidin-1-yl)methanone (PubChem CID 51331040) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is [1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-(2-methylpiperidin-1-yl)methanone.
| Compound Name | [1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 51331040 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-(2-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCCN1C(=O)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O3S/c1-13-5-2-3-10-21(13)17(22)14-7-11-20(12-8-14)25(23,24)15-6-4-9-19-16(15)18/h4,6,9,13-14H,2-3,5,7-8,10-12H2,1H3 |
| InChIKey | XLWWNMBJMVBDIG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|