C21H21ClF3N3O3S — CID 31845377
[1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methanone (PubChem CID 31845377) has the molecular formula C21H21ClF3N3O3S and a molecular weight of 487.93 g/mol. Its IUPAC name is [1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methanone.
| Compound Name | [1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methanone |
|---|---|
| PubChem CID | 31845377 |
| Molecular Formula | C21H21ClF3N3O3S |
| Molecular Weight | 487.93 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | [1-[(2-chloro-3-pyridinyl)sulfonyl]piperidin-4-yl]-[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccnc2Cl)CC1)N1CCCc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H21ClF3N3O3S/c22-19-18(4-1-9-26-19)32(30,31)27-11-7-14(8-12-27)20(29)28-10-2-3-15-13-16(21(23,24)25)5-6-17(15)28/h1,4-6,9,13-14H,2-3,7-8,10-12H2 |
| InChIKey | MJHJCMGRDTYXIO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.93 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|