C21H26ClN3O5S — CID 55897211
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpiperidine-4-carboxamide (PubChem CID 55897211) has the molecular formula C21H26ClN3O5S and a molecular weight of 467.98 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55897211 |
| Molecular Formula | C21H26ClN3O5S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-[2-(2-methoxyphenoxy)ethyl]-N-methylpiperidine-4-carboxamide |
| SMILES | COc1ccccc1OCCN(C)C(=O)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C21H26ClN3O5S/c1-24(14-15-30-18-7-4-3-6-17(18)29-2)21(26)16-9-12-25(13-10-16)31(27,28)19-8-5-11-23-20(19)22/h3-8,11,16H,9-10,12-15H2,1-2H3 |
| InChIKey | PHPJRHGLXQIXJN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|