C21H26ClN3O3S — CID 55587245
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-ethyl-N-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 55587245) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-ethyl-N-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-ethyl-N-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55587245 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-ethyl-N-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | CCN(CCc1ccccc1)C(=O)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C21H26ClN3O3S/c1-2-24(14-10-17-7-4-3-5-8-17)21(26)18-11-15-25(16-12-18)29(27,28)19-9-6-13-23-20(19)22/h3-9,13,18H,2,10-12,14-16H2,1H3 |
| InChIKey | OJWCBPYDOWKVCV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|