C21H23ClFN3O3S — CID 31122765
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 31122765) has the molecular formula C21H23ClFN3O3S and a molecular weight of 451.95 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31122765 |
| Molecular Formula | C21H23ClFN3O3S |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccnc2Cl)CC1)N(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C21H23ClFN3O3S/c22-20-19(2-1-11-24-20)30(28,29)25-12-9-16(10-13-25)21(27)26(18-7-8-18)14-15-3-5-17(23)6-4-15/h1-6,11,16,18H,7-10,12-14H2 |
| InChIKey | ZXASNURJFBAOSB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|