C26H30ClFN2O2 — CID 43025139
1-(4-chlorobenzoyl)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 43025139) has the molecular formula C26H30ClFN2O2 and a molecular weight of 456.99 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43025139 |
| Molecular Formula | C26H30ClFN2O2 |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-cyclohexyl-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCC(C(=O)N(Cc2ccc(F)cc2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H30ClFN2O2/c27-22-10-8-20(9-11-22)25(31)29-16-14-21(15-17-29)26(32)30(24-4-2-1-3-5-24)18-19-6-12-23(28)13-7-19/h6-13,21,24H,1-5,14-18H2 |
| InChIKey | BBHKAKPULSBGIR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |