C24H27ClN2O2 — CID 46592114
1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 46592114) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46592114 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(CN(C(=O)C2CCCN(C(=O)c3ccc(Cl)cc3)C2)C2CC2)cc1 |
| InChI | InChI=1S/C24H27ClN2O2/c1-17-4-6-18(7-5-17)15-27(22-12-13-22)24(29)20-3-2-14-26(16-20)23(28)19-8-10-21(25)11-9-19/h4-11,20,22H,2-3,12-16H2,1H3 |
| InChIKey | VKCNHAGQWXIDHK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |