C20H22ClNO2 — CID 160998375
[3-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(4-methylphenyl)methanone (PubChem CID 160998375) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is [3-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [3-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 160998375 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [3-[(S)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC([C@H](O)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C20H22ClNO2/c1-14-4-6-16(7-5-14)20(24)22-12-2-3-17(13-22)19(23)15-8-10-18(21)11-9-15/h4-11,17,19,23H,2-3,12-13H2,1H3/t17?,19-/m1/s1 |
| InChIKey | TVNUAXDCZQWTFI-WHCXFUJUSA-N |
| XLogP | 4.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |