C23H24ClFN2O2 — CID 55396606
1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 55396606) has the molecular formula C23H24ClFN2O2 and a molecular weight of 414.91 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55396606 |
| Molecular Formula | C23H24ClFN2O2 |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-cyclopropyl-N-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC(C(=O)N(Cc2ccc(F)cc2)C2CC2)C1 |
| InChI | InChI=1S/C23H24ClFN2O2/c24-19-7-5-17(6-8-19)22(28)26-13-1-2-18(15-26)23(29)27(21-11-12-21)14-16-3-9-20(25)10-4-16/h3-10,18,21H,1-2,11-15H2 |
| InChIKey | LSDYWVJHHQKEPG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |