C19H21ClN4O2 — CID 51185593
1-(4-chlorobenzoyl)-N,N-bis(2-cyanoethyl)piperidine-3-carboxamide (PubChem CID 51185593) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N,N-bis(2-cyanoethyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N,N-bis(2-cyanoethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51185593 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N,N-bis(2-cyanoethyl)piperidine-3-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)C1CCCN(C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H21ClN4O2/c20-17-7-5-15(6-8-17)18(25)24-11-1-4-16(14-24)19(26)23(12-2-9-21)13-3-10-22/h5-8,16H,1-4,11-14H2 |
| InChIKey | FKJXTKQQEXSPAG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |