C21H23ClN4O3S — CID 60615480
1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-cyanophenyl)-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 60615480) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-cyanophenyl)-N-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-cyanophenyl)-N-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60615480 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-N-(3-cyanophenyl)-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)N(C(=O)C1CCN(S(=O)(=O)c2cccnc2Cl)CC1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-15(2)26(18-6-3-5-16(13-18)14-23)21(27)17-8-11-25(12-9-17)30(28,29)19-7-4-10-24-20(19)22/h3-7,10,13,15,17H,8-9,11-12H2,1-2H3 |
| InChIKey | SWIQLWCLIVEJOV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 94.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|