C21H26N4O3S — CID 60615586
N-(3-cyanophenyl)-1-methyl-4-piperidin-1-ylsulfonyl-N-propan-2-ylpyrrole-2-carboxamide (PubChem CID 60615586) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(3-cyanophenyl)-1-methyl-4-piperidin-1-ylsulfonyl-N-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | N-(3-cyanophenyl)-1-methyl-4-piperidin-1-ylsulfonyl-N-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60615586 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-(3-cyanophenyl)-1-methyl-4-piperidin-1-ylsulfonyl-N-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)N(C(=O)c1cc(S(=O)(=O)N2CCCCC2)cn1C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C21H26N4O3S/c1-16(2)25(18-9-7-8-17(12-18)14-22)21(26)20-13-19(15-23(20)3)29(27,28)24-10-5-4-6-11-24/h7-9,12-13,15-16H,4-6,10-11H2,1-3H3 |
| InChIKey | BCDJPUGMPVSQRB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |