C22H25N3O3S — CID 108736551
N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-cyanobenzamide (PubChem CID 108736551) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-cyanobenzamide.
| Compound Name | N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 108736551 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)NCCc2ccc(S(=O)(=O)N3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H25N3O3S/c23-17-19-6-5-7-20(16-19)22(26)24-13-12-18-8-10-21(11-9-18)29(27,28)25-14-3-1-2-4-15-25/h5-11,16H,1-4,12-15H2,(H,24,26) |
| InChIKey | QQOFHEJKSBFKMJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |