C13H17FN2O4S — CID 82845277
methyl 1-(4-amino-3-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 82845277) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl 1-(4-amino-3-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-(4-amino-3-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 82845277 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl 1-(4-amino-3-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2ccc(N)c(F)c2)CC1 |
| InChI | InChI=1S/C13H17FN2O4S/c1-20-13(17)9-4-6-16(7-5-9)21(18,19)10-2-3-12(15)11(14)8-10/h2-3,8-9H,4-7,15H2,1H3 |
| InChIKey | HLRVOEYWOSCVRK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|