C18H24N2O6S — CID 43908989
methyl 1-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 43908989) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is methyl 1-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 43908989 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl 1-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2ccc(OC)c(N3CCCC3=O)c2)CC1 |
| InChI | InChI=1S/C18H24N2O6S/c1-25-16-6-5-14(12-15(16)20-9-3-4-17(20)21)27(23,24)19-10-7-13(8-11-19)18(22)26-2/h5-6,12-13H,3-4,7-11H2,1-2H3 |
| InChIKey | HTZKGIJIEKMPOT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |