C18H25N3O6S — CID 30385367
ethyl 4-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 30385367) has the molecular formula C18H25N3O6S and a molecular weight of 411.48 g/mol. Its IUPAC name is ethyl 4-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 30385367 |
| Molecular Formula | C18H25N3O6S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | ethyl 4-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc(OC)c(N3CCCC3=O)c2)CC1 |
| InChI | InChI=1S/C18H25N3O6S/c1-3-27-18(23)19-9-11-20(12-10-19)28(24,25)14-6-7-16(26-2)15(13-14)21-8-4-5-17(21)22/h6-7,13H,3-5,8-12H2,1-2H3 |
| InChIKey | JSTZCELMFCZKAV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |