C14H17F2NO6S2 — CID 34032036
methyl 1-[4-(difluoromethylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 34032036) has the molecular formula C14H17F2NO6S2 and a molecular weight of 397.42 g/mol. Its IUPAC name is methyl 1-[4-(difluoromethylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[4-(difluoromethylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 34032036 |
| Molecular Formula | C14H17F2NO6S2 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | methyl 1-[4-(difluoromethylsulfonyl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2ccc(S(=O)(=O)C(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H17F2NO6S2/c1-23-13(18)10-6-8-17(9-7-10)25(21,22)12-4-2-11(3-5-12)24(19,20)14(15)16/h2-5,10,14H,6-9H2,1H3 |
| InChIKey | JGUPDOOOCIFOFK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |