C16H20N2O5S — CID 67192747
methyl 1-[4-(prop-2-enoylamino)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 67192747) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is methyl 1-[4-(prop-2-enoylamino)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[4-(prop-2-enoylamino)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 67192747 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | methyl 1-[4-(prop-2-enoylamino)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | C=CC(=O)Nc1ccc(S(=O)(=O)N2CCC(C(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-3-15(19)17-13-4-6-14(7-5-13)24(21,22)18-10-8-12(9-11-18)16(20)23-2/h3-7,12H,1,8-11H2,2H3,(H,17,19) |
| InChIKey | WKSKBZPQXPYVTR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|