C20H28N4O4S — CID 67196353
N-[4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide (PubChem CID 67196353) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-[4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide.
| Compound Name | N-[4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67196353 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]sulfonylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(S(=O)(=O)N2CCN(CC(=O)N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C20H28N4O4S/c1-2-19(25)21-17-6-8-18(9-7-17)29(27,28)24-14-12-22(13-15-24)16-20(26)23-10-4-3-5-11-23/h2,6-9H,1,3-5,10-16H2,(H,21,25) |
| InChIKey | HSWKMMBJVFXIBD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|