C19H25N3O4S — CID 89236264
N-[4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide (PubChem CID 89236264) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 89236264 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylphenyl]cyclopropanecarboxamide |
| SMILES | C=CC(=O)NCC1CCN(S(=O)(=O)c2ccc(NC(=O)C3CC3)cc2)CC1 |
| InChI | InChI=1S/C19H25N3O4S/c1-2-18(23)20-13-14-9-11-22(12-10-14)27(25,26)17-7-5-16(6-8-17)21-19(24)15-3-4-15/h2,5-8,14-15H,1,3-4,9-13H2,(H,20,23)(H,21,24) |
| InChIKey | XPYODZMJYJKLTK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|