C23H32F2N4O4S — CID 89236254
N-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylbenzamide (PubChem CID 89236254) has the molecular formula C23H32F2N4O4S and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89236254 |
| Molecular Formula | C23H32F2N4O4S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[2-(4,4-difluoropiperidin-1-yl)ethyl]-4-[4-[(prop-2-enoylamino)methyl]piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NCC1CCN(S(=O)(=O)c2ccc(C(=O)NCCN3CCC(F)(F)CC3)cc2)CC1 |
| InChI | InChI=1S/C23H32F2N4O4S/c1-2-21(30)27-17-18-7-12-29(13-8-18)34(32,33)20-5-3-19(4-6-20)22(31)26-11-16-28-14-9-23(24,25)10-15-28/h2-6,18H,1,7-17H2,(H,26,31)(H,27,30) |
| InChIKey | RLBLMOIIVMARQR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|