C22H31N3O5S — CID 71454790
N-[2-(oxan-4-yl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide (PubChem CID 71454790) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is N-[2-(oxan-4-yl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(oxan-4-yl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 71454790 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[2-(oxan-4-yl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)NCCC3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C22H31N3O5S/c1-2-21(26)24-19-8-13-25(14-9-19)31(28,29)20-5-3-18(4-6-20)22(27)23-12-7-17-10-15-30-16-11-17/h2-6,17,19H,1,7-16H2,(H,23,27)(H,24,26) |
| InChIKey | URLJMCIBZUDAAX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|