C25H31N3O6S — CID 71449440
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide (PubChem CID 71449440) has the molecular formula C25H31N3O6S and a molecular weight of 501.61 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 71449440 |
| Molecular Formula | C25H31N3O6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)NCCc3ccc(OC)c(OC)c3)cc2)CC1 |
| InChI | InChI=1S/C25H31N3O6S/c1-4-24(29)27-20-12-15-28(16-13-20)35(31,32)21-8-6-19(7-9-21)25(30)26-14-11-18-5-10-22(33-2)23(17-18)34-3/h4-10,17,20H,1,11-16H2,2-3H3,(H,26,30)(H,27,29) |
| InChIKey | HDKRHKNPKSVEFV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|