C25H29N3O6S — CID 89238310
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]benzamide (PubChem CID 89238310) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89238310 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[6-(prop-2-enoylamino)-3-azabicyclo[3.1.0]hexan-3-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)NC1C2CN(S(=O)(=O)c3ccc(C(=O)NCCc4ccc(OC)c(OC)c4)cc3)CC21 |
| InChI | InChI=1S/C25H29N3O6S/c1-4-23(29)27-24-19-14-28(15-20(19)24)35(31,32)18-8-6-17(7-9-18)25(30)26-12-11-16-5-10-21(33-2)22(13-16)34-3/h4-10,13,19-20,24H,1,11-12,14-15H2,2-3H3,(H,26,30)(H,27,29) |
| InChIKey | QCVGXXOCGMPWRK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|