C28H37N3O6S — CID 89238920
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide (PubChem CID 89238920) has the molecular formula C28H37N3O6S and a molecular weight of 543.69 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89238920 |
| Molecular Formula | C28H37N3O6S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CC(C)(C)N(S(=O)(=O)c2ccc(C(=O)NCCc3ccc(OC)c(OC)c3)cc2)C1(C)C |
| InChI | InChI=1S/C28H37N3O6S/c1-8-25(32)30-24-18-27(2,3)31(28(24,4)5)38(34,35)21-12-10-20(11-13-21)26(33)29-16-15-19-9-14-22(36-6)23(17-19)37-7/h8-14,17,24H,1,15-16,18H2,2-7H3,(H,29,33)(H,30,32) |
| InChIKey | NLUHWLBJCSXKBW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|