C27H33N3O6S — CID 89236618
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide (PubChem CID 89236618) has the molecular formula C27H33N3O6S and a molecular weight of 527.64 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89236618 |
| Molecular Formula | C27H33N3O6S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[2,2,5,5-tetramethyl-3-(prop-2-enoylamino)pyrrolidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CC(C)(C)N(S(=O)(=O)c2ccc(C(=O)NCCc3ccc4c(c3)OCO4)cc2)C1(C)C |
| InChI | InChI=1S/C27H33N3O6S/c1-6-24(31)29-23-16-26(2,3)30(27(23,4)5)37(33,34)20-10-8-19(9-11-20)25(32)28-14-13-18-7-12-21-22(15-18)36-17-35-21/h6-12,15,23H,1,13-14,16-17H2,2-5H3,(H,28,32)(H,29,31) |
| InChIKey | WOYSCEJFXUIECW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|