C27H34ClN3O4S — CID 89236085
N-[2-(4-chlorophenyl)ethyl]-4-[2,2,6,6-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide (PubChem CID 89236085) has the molecular formula C27H34ClN3O4S and a molecular weight of 532.11 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-[2,2,6,6-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-[2,2,6,6-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89236085 |
| Molecular Formula | C27H34ClN3O4S |
| Molecular Weight | 532.11 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-[2,2,6,6-tetramethyl-4-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CC(C)(C)N(S(=O)(=O)c2ccc(C(=O)NCCc3ccc(Cl)cc3)cc2)C(C)(C)C1 |
| InChI | InChI=1S/C27H34ClN3O4S/c1-6-24(32)30-22-17-26(2,3)31(27(4,5)18-22)36(34,35)23-13-9-20(10-14-23)25(33)29-16-15-19-7-11-21(28)12-8-19/h6-14,22H,1,15-18H2,2-5H3,(H,29,33)(H,30,32) |
| InChIKey | OJDKCLKLCMMOMK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.11 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|