C30H39N3O4S — CID 89238737
N-[2-(4-tert-butylphenyl)ethyl]-4-[[8-(prop-2-enoylamino)-5-azaspiro[3.5]nonan-5-yl]sulfonyl]benzamide (PubChem CID 89238737) has the molecular formula C30H39N3O4S and a molecular weight of 537.73 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)ethyl]-4-[[8-(prop-2-enoylamino)-5-azaspiro[3.5]nonan-5-yl]sulfonyl]benzamide.
| Compound Name | N-[2-(4-tert-butylphenyl)ethyl]-4-[[8-(prop-2-enoylamino)-5-azaspiro[3.5]nonan-5-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89238737 |
| Molecular Formula | C30H39N3O4S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)ethyl]-4-[[8-(prop-2-enoylamino)-5-azaspiro[3.5]nonan-5-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)NCCc3ccc(C(C)(C)C)cc3)cc2)C2(CCC2)C1 |
| InChI | InChI=1S/C30H39N3O4S/c1-5-27(34)32-25-16-20-33(30(21-25)17-6-18-30)38(36,37)26-13-9-23(10-14-26)28(35)31-19-15-22-7-11-24(12-8-22)29(2,3)4/h5,7-14,25H,1,6,15-21H2,2-4H3,(H,31,35)(H,32,34) |
| InChIKey | OUPAUFNHANGLIW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|