C31H35N3O4S — CID 89237915
N-[2-(4-tert-butylphenyl)ethyl]-4-[[4-(prop-2-enoylamino)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzamide (PubChem CID 89237915) has the molecular formula C31H35N3O4S and a molecular weight of 545.71 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)ethyl]-4-[[4-(prop-2-enoylamino)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzamide.
| Compound Name | N-[2-(4-tert-butylphenyl)ethyl]-4-[[4-(prop-2-enoylamino)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89237915 |
| Molecular Formula | C31H35N3O4S |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)ethyl]-4-[[4-(prop-2-enoylamino)-3,4-dihydro-2H-quinolin-1-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(C(=O)NCCc3ccc(C(C)(C)C)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C31H35N3O4S/c1-5-29(35)33-27-19-21-34(28-9-7-6-8-26(27)28)39(37,38)25-16-12-23(13-17-25)30(36)32-20-18-22-10-14-24(15-11-22)31(2,3)4/h5-17,27H,1,18-21H2,2-4H3,(H,32,36)(H,33,35) |
| InChIKey | LAYXODDBEMGSJX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|