C20H20N2O5S — CID 89238952
N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide (PubChem CID 89238952) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238952 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O5S/c1-2-20(23)21-16-9-10-22(17-6-4-3-5-15(16)17)28(24,25)14-7-8-18-19(13-14)27-12-11-26-18/h2-8,13,16H,1,9-12H2,(H,21,23) |
| InChIKey | ATBRQAYMMPNACS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|