C30H33N3O4S — CID 89237765
N-[2-(4-phenylphenyl)ethyl]-4-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylbenzamide (PubChem CID 89237765) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is N-[2-(4-phenylphenyl)ethyl]-4-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(4-phenylphenyl)ethyl]-4-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89237765 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | N-[2-(4-phenylphenyl)ethyl]-4-[4-(prop-2-enoylamino)azepan-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)NC1CCCN(S(=O)(=O)c2ccc(C(=O)NCCc3ccc(-c4ccccc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H33N3O4S/c1-2-29(34)32-27-9-6-21-33(22-19-27)38(36,37)28-16-14-26(15-17-28)30(35)31-20-18-23-10-12-25(13-11-23)24-7-4-3-5-8-24/h2-5,7-8,10-17,27H,1,6,9,18-22H2,(H,31,35)(H,32,34) |
| InChIKey | NUQODUVXBLYBFG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|