C24H27N3O6S — CID 89236665
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide (PubChem CID 89236665) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 89236665 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3S)-3-(prop-2-enoylamino)piperidin-1-yl]sulfonylbenzamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(S(=O)(=O)c2ccc(C(=O)NCCc3ccc4c(c3)OCO4)cc2)C1 |
| InChI | InChI=1S/C24H27N3O6S/c1-2-23(28)26-19-4-3-13-27(15-19)34(30,31)20-8-6-18(7-9-20)24(29)25-12-11-17-5-10-21-22(14-17)33-16-32-21/h2,5-10,14,19H,1,3-4,11-13,15-16H2,(H,25,29)(H,26,28)/t19-/m0/s1 |
| InChIKey | LCRYGLFDZAYXOP-IBGZPJMESA-N |
| XLogP | 1.84 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|