C27H30N4O4S — CID 89236290
4-[3-(prop-2-enoylamino)azepan-1-yl]sulfonyl-N-(2-quinolin-7-ylethyl)benzamide (PubChem CID 89236290) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is 4-[3-(prop-2-enoylamino)azepan-1-yl]sulfonyl-N-(2-quinolin-7-ylethyl)benzamide.
| Compound Name | 4-[3-(prop-2-enoylamino)azepan-1-yl]sulfonyl-N-(2-quinolin-7-ylethyl)benzamide |
|---|---|
| PubChem CID | 89236290 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-[3-(prop-2-enoylamino)azepan-1-yl]sulfonyl-N-(2-quinolin-7-ylethyl)benzamide |
| SMILES | C=CC(=O)NC1CCCCN(S(=O)(=O)c2ccc(C(=O)NCCc3ccc4cccnc4c3)cc2)C1 |
| InChI | InChI=1S/C27H30N4O4S/c1-2-26(32)30-23-7-3-4-17-31(19-23)36(34,35)24-12-10-22(11-13-24)27(33)29-16-14-20-8-9-21-6-5-15-28-25(21)18-20/h2,5-6,8-13,15,18,23H,1,3-4,7,14,16-17,19H2,(H,29,33)(H,30,32) |
| InChIKey | RURFDYQBBCLUKZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|