C28H29N3O4S2 — CID 89237195
N-(2-naphthalen-2-ylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide (PubChem CID 89237195) has the molecular formula C28H29N3O4S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is N-(2-naphthalen-2-ylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide.
| Compound Name | N-(2-naphthalen-2-ylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89237195 |
| Molecular Formula | C28H29N3O4S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | N-(2-naphthalen-2-ylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(C(=O)NCCc4ccc5ccccc5c4)cc3)CC2S1 |
| InChI | InChI=1S/C28H29N3O4S2/c1-2-26(32)30-27-16-23-17-31(18-25(23)36-27)37(34,35)24-11-9-21(10-12-24)28(33)29-14-13-19-7-8-20-5-3-4-6-22(20)15-19/h2-12,15,23,25,27H,1,13-14,16-18H2,(H,29,33)(H,30,32) |
| InChIKey | CUQHXVQHVONIAK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|