C24H26FN3O4S2 — CID 89238408
2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide (PubChem CID 89238408) has the molecular formula C24H26FN3O4S2 and a molecular weight of 503.62 g/mol. Its IUPAC name is 2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide.
| Compound Name | 2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89238408 |
| Molecular Formula | C24H26FN3O4S2 |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(C(=O)NCCc4ccccc4)c(F)c3)CC2S1 |
| InChI | InChI=1S/C24H26FN3O4S2/c1-2-22(29)27-23-12-17-14-28(15-21(17)33-23)34(31,32)18-8-9-19(20(25)13-18)24(30)26-11-10-16-6-4-3-5-7-16/h2-9,13,17,21,23H,1,10-12,14-15H2,(H,26,30)(H,27,29) |
| InChIKey | NQHXQNDQXMVTCB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|