C26H33N3O4S2 — CID 89237572
N-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]adamantane-1-carboxamide (PubChem CID 89237572) has the molecular formula C26H33N3O4S2 and a molecular weight of 515.70 g/mol. Its IUPAC name is N-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 89237572 |
| Molecular Formula | C26H33N3O4S2 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]phenyl]adamantane-1-carboxamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(NC(=O)C45CC6CC(CC(C6)C4)C5)cc3)CC2S1 |
| InChI | InChI=1S/C26H33N3O4S2/c1-2-23(30)28-24-10-19-14-29(15-22(19)34-24)35(32,33)21-5-3-20(4-6-21)27-25(31)26-11-16-7-17(12-26)9-18(8-16)13-26/h2-6,16-19,22,24H,1,7-15H2,(H,27,31)(H,28,30) |
| InChIKey | SKHVEFVFUGPILW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|