C16H17N3O3S3 — CID 89236770
N-[5-(1,3-benzothiazol-6-ylsulfonyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89236770) has the molecular formula C16H17N3O3S3 and a molecular weight of 395.53 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-6-ylsulfonyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-(1,3-benzothiazol-6-ylsulfonyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89236770 |
| Molecular Formula | C16H17N3O3S3 |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-[5-(1,3-benzothiazol-6-ylsulfonyl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc4ncsc4c3)CC2S1 |
| InChI | InChI=1S/C16H17N3O3S3/c1-2-15(20)18-16-5-10-7-19(8-14(10)24-16)25(21,22)11-3-4-12-13(6-11)23-9-17-12/h2-4,6,9-10,14,16H,1,5,7-8H2,(H,18,20) |
| InChIKey | SDCXPAYOCWCIQW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|