C16H19N3O3S2 — CID 89236543
N-[1-(1,3-benzothiazol-6-ylsulfonyl)-4-methylpiperidin-4-yl]prop-2-enamide (PubChem CID 89236543) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-6-ylsulfonyl)-4-methylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[1-(1,3-benzothiazol-6-ylsulfonyl)-4-methylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89236543 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[1-(1,3-benzothiazol-6-ylsulfonyl)-4-methylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1(C)CCN(S(=O)(=O)c2ccc3ncsc3c2)CC1 |
| InChI | InChI=1S/C16H19N3O3S2/c1-3-15(20)18-16(2)6-8-19(9-7-16)24(21,22)12-4-5-13-14(10-12)23-11-17-13/h3-5,10-11H,1,6-9H2,2H3,(H,18,20) |
| InChIKey | HRBVOXUBKMEVAY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|