C21H29N3O4S — CID 89238146
N-[4-methyl-1-[4-(piperidine-1-carbonyl)phenyl]sulfonylpiperidin-4-yl]prop-2-enamide (PubChem CID 89238146) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[4-methyl-1-[4-(piperidine-1-carbonyl)phenyl]sulfonylpiperidin-4-yl]prop-2-enamide.
| Compound Name | N-[4-methyl-1-[4-(piperidine-1-carbonyl)phenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238146 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[4-methyl-1-[4-(piperidine-1-carbonyl)phenyl]sulfonylpiperidin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1(C)CCN(S(=O)(=O)c2ccc(C(=O)N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H29N3O4S/c1-3-19(25)22-21(2)11-15-24(16-12-21)29(27,28)18-9-7-17(8-10-18)20(26)23-13-5-4-6-14-23/h3,7-10H,1,4-6,11-16H2,2H3,(H,22,25) |
| InChIKey | AOVAFOKGUHQULS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|