C19H27N3O3S — CID 113072709
(4-piperidin-1-ylsulfonylphenyl)-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 113072709) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is (4-piperidin-1-ylsulfonylphenyl)-(4-prop-2-enylpiperazin-1-yl)methanone.
| Compound Name | (4-piperidin-1-ylsulfonylphenyl)-(4-prop-2-enylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 113072709 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (4-piperidin-1-ylsulfonylphenyl)-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O3S/c1-2-10-20-13-15-21(16-14-20)19(23)17-6-8-18(9-7-17)26(24,25)22-11-4-3-5-12-22/h2,6-9H,1,3-5,10-16H2 |
| InChIKey | LHYGCYZLQNFDHD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|